About N-buta-1,3-dien-2-yl-3-methylbutan-1-amine
N-buta-1,3-dien-2-yl-3-methylbutan-1-amine (PubChem CID 126513733) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-3-methylbutan-1-amine.
Molecular Properties
| Compound Name | N-buta-1,3-dien-2-yl-3-methylbutan-1-amine |
| PubChem CID | 126513733 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N-buta-1,3-dien-2-yl-3-methylbutan-1-amine |
| SMILES | C=CC(=C)NCCC(C)C |
| InChI | InChI=1S/C9H17N/c1-5-9(4)10-7-6-8(2)3/h5,8,10H,1,4,6-7H2,2-3H3 |
| InChIKey | TWKTZOPQIGPGRL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-buta-1,3-dien-2-yl-3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,3-dien-2-yl-3-methylbutan-1-amine?
The IUPAC name of N-buta-1,3-dien-2-yl-3-methylbutan-1-amine (CID 126513733) is N-buta-1,3-dien-2-yl-3-methylbutan-1-amine.
What is the SMILES notation for N-buta-1,3-dien-2-yl-3-methylbutan-1-amine?
The canonical SMILES for N-buta-1,3-dien-2-yl-3-methylbutan-1-amine is C=CC(=C)NCCC(C)C.
What is the InChIKey of N-buta-1,3-dien-2-yl-3-methylbutan-1-amine?
The InChIKey is TWKTZOPQIGPGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-5-9(4)10-7-6-8(2)3/h5,8,10H,1,4,6-7H2,2-3H3.
What are the key properties of N-buta-1,3-dien-2-yl-3-methylbutan-1-amine?
N-buta-1,3-dien-2-yl-3-methylbutan-1-amine has a molecular weight of 139.24 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,3-dien-2-yl-3-methylbutan-1-amine is sourced from PubChem (CID 126513733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).