C17H30N2S — CID 126513947
(E)-N'-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]-3-(2,2-dimethylpropylsulfanyl)prop-2-enimidamide (PubChem CID 126513947) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is (E)-N'-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]-3-(2,2-dimethylpropylsulfanyl)prop-2-enimidamide.
| Compound Name | (E)-N'-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]-3-(2,2-dimethylpropylsulfanyl)prop-2-enimidamide |
|---|---|
| PubChem CID | 126513947 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (E)-N'-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]-3-(2,2-dimethylpropylsulfanyl)prop-2-enimidamide |
| SMILES | C/C=C(\C=C/N=C(N)/C=C/SCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H30N2S/c1-8-14(17(5,6)7)9-11-19-15(18)10-12-20-13-16(2,3)4/h8-12H,13H2,1-7H3,(H2,18,19)/b11-9-,12-10+,14-8+ |
| InChIKey | SRQSUYAZPHONMK-GNERPUFASA-N |
| XLogP | 5.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|