About 6-chloro-1,2-dihydropyridine-3-carbonyl chloride
6-chloro-1,2-dihydropyridine-3-carbonyl chloride (PubChem CID 126514813) has the molecular formula C6H5Cl2NO
and a molecular weight of 178.02 g/mol. Its IUPAC name is 6-chloro-1,2-dihydropyridine-3-carbonyl chloride.
Molecular Properties
| Compound Name | 6-chloro-1,2-dihydropyridine-3-carbonyl chloride |
| PubChem CID | 126514813 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 6-chloro-1,2-dihydropyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)C1=CC=C(Cl)NC1 |
| InChI | InChI=1S/C6H5Cl2NO/c7-5-2-1-4(3-9-5)6(8)10/h1-2,9H,3H2 |
| InChIKey | KAZKAHMJKLJAHH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,2-dihydropyridine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,2-dihydropyridine-3-carbonyl chloride?
The IUPAC name of 6-chloro-1,2-dihydropyridine-3-carbonyl chloride (CID 126514813) is 6-chloro-1,2-dihydropyridine-3-carbonyl chloride.
What is the SMILES notation for 6-chloro-1,2-dihydropyridine-3-carbonyl chloride?
The canonical SMILES for 6-chloro-1,2-dihydropyridine-3-carbonyl chloride is O=C(Cl)C1=CC=C(Cl)NC1.
What is the InChIKey of 6-chloro-1,2-dihydropyridine-3-carbonyl chloride?
The InChIKey is KAZKAHMJKLJAHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2NO/c7-5-2-1-4(3-9-5)6(8)10/h1-2,9H,3H2.
What are the key properties of 6-chloro-1,2-dihydropyridine-3-carbonyl chloride?
6-chloro-1,2-dihydropyridine-3-carbonyl chloride has a molecular weight of 178.02 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,2-dihydropyridine-3-carbonyl chloride is sourced from PubChem (CID 126514813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).