C21H33N — CID 126514946
(2E,4E)-3-cyclopropyl-2-ethenyl-N-[(4E)-5-methylocta-1,4-dien-4-yl]hepta-2,4-dien-1-amine (PubChem CID 126514946) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is (2E,4E)-3-cyclopropyl-2-ethenyl-N-[(4E)-5-methylocta-1,4-dien-4-yl]hepta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-3-cyclopropyl-2-ethenyl-N-[(4E)-5-methylocta-1,4-dien-4-yl]hepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 126514946 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (2E,4E)-3-cyclopropyl-2-ethenyl-N-[(4E)-5-methylocta-1,4-dien-4-yl]hepta-2,4-dien-1-amine |
| SMILES | C=CC/C(NC/C(C=C)=C(/C=C/CC)C1CC1)=C(/C)CCC |
| InChI | InChI=1S/C21H33N/c1-6-10-13-20(19-14-15-19)18(9-4)16-22-21(12-8-3)17(5)11-7-2/h8-10,13,19,22H,3-4,6-7,11-12,14-16H2,1-2,5H3/b13-10+,20-18-,21-17+ |
| InChIKey | OIJUMQJXZUCIBW-TUXFBXGISA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|