C29H36N4O2 — CID 126515001
N-(2-aminoethyl)-N-[3,6-bis(ethylamino)-2,7-dimethyl-9-(2-methylphenyl)xanthen-9-yl]formamide (PubChem CID 126515001) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[3,6-bis(ethylamino)-2,7-dimethyl-9-(2-methylphenyl)xanthen-9-yl]formamide.
| Compound Name | N-(2-aminoethyl)-N-[3,6-bis(ethylamino)-2,7-dimethyl-9-(2-methylphenyl)xanthen-9-yl]formamide |
|---|---|
| PubChem CID | 126515001 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | N-(2-aminoethyl)-N-[3,6-bis(ethylamino)-2,7-dimethyl-9-(2-methylphenyl)xanthen-9-yl]formamide |
| SMILES | CCNc1cc2c(cc1C)C(c1ccccc1C)(N(C=O)CCN)c1cc(C)c(NCC)cc1O2 |
| InChI | InChI=1S/C29H36N4O2/c1-6-31-25-16-27-23(14-20(25)4)29(33(18-34)13-12-30,22-11-9-8-10-19(22)3)24-15-21(5)26(32-7-2)17-28(24)35-27/h8-11,14-18,31-32H,6-7,12-13,30H2,1-5H3 |
| InChIKey | UGGJKFBZLSRXLU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|