C24H23N7OS — CID 126515165
N'-[amino-[(5-phenacylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide (PubChem CID 126515165) has the molecular formula C24H23N7OS and a molecular weight of 457.56 g/mol. Its IUPAC name is N'-[amino-[(5-phenacylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide.
| Compound Name | N'-[amino-[(5-phenacylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 126515165 |
| Molecular Formula | C24H23N7OS |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N'-[amino-[(5-phenacylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide |
| SMILES | N/C(=N\N(N)Cc1nnc(SCC(=O)c2ccccc2)n1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N7OS/c25-23(19-12-6-2-7-13-19)29-30(26)16-22-27-28-24(31(22)20-14-8-3-9-15-20)33-17-21(32)18-10-4-1-5-11-18/h1-15H,16-17,26H2,(H2,25,29) |
| InChIKey | HWFVHNDFJJWTHL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|