C14H16S — CID 126515640
(4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-4,5-di(ethylidene)thiophene (PubChem CID 126515640) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is (4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-4,5-di(ethylidene)thiophene.
| Compound Name | (4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-4,5-di(ethylidene)thiophene |
|---|---|
| PubChem CID | 126515640 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (4Z,5E)-2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-4,5-di(ethylidene)thiophene |
| SMILES | C=C/C=C\c1sc(=C/C)/c(=C\C)c1C=C |
| InChI | InChI=1S/C14H16S/c1-5-9-10-14-12(7-3)11(6-2)13(8-4)15-14/h5-10H,1,3H2,2,4H3/b10-9-,11-6-,13-8+ |
| InChIKey | CZSLQZFPRXQASP-JPMURYSISA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|