About (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol
(3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol (PubChem CID 126515935) has the molecular formula C12H20S2
and a molecular weight of 228.43 g/mol. Its IUPAC name is (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol.
Molecular Properties
| Compound Name | (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol |
| PubChem CID | 126515935 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol |
| SMILES | CCSC1=CC(S)=C(CC)[C@@H](CC)C1 |
| InChI | InChI=1S/C12H20S2/c1-4-9-7-10(14-6-3)8-12(13)11(9)5-2/h8-9,13H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | FHNYTECNQBKTLF-VIFPVBQESA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol?
The IUPAC name of (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol (CID 126515935) is (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol.
What is the SMILES notation for (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol?
The canonical SMILES for (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol is CCSC1=CC(S)=C(CC)[C@@H](CC)C1.
What is the InChIKey of (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol?
The InChIKey is FHNYTECNQBKTLF-VIFPVBQESA-N. The full InChI is InChI=1S/C12H20S2/c1-4-9-7-10(14-6-3)8-12(13)11(9)5-2/h8-9,13H,4-7H2,1-3H3/t9-/m0/s1.
What are the key properties of (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol?
(3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol has a molecular weight of 228.43 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,3-diethyl-5-ethylsulfanylcyclohexa-1,5-diene-1-thiol is sourced from PubChem (CID 126515935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).