C18H22FN — CID 126516076
(2E,4E,6E)-N-ethenyl-8-fluoro-5-methyl-6-[(Z)-prop-1-enyl]-2-prop-1-en-2-ylnona-2,4,6,8-tetraen-1-imine (PubChem CID 126516076) has the molecular formula C18H22FN and a molecular weight of 271.38 g/mol. Its IUPAC name is (2E,4E,6E)-N-ethenyl-8-fluoro-5-methyl-6-[(Z)-prop-1-enyl]-2-prop-1-en-2-ylnona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6E)-N-ethenyl-8-fluoro-5-methyl-6-[(Z)-prop-1-enyl]-2-prop-1-en-2-ylnona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 126516076 |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2E,4E,6E)-N-ethenyl-8-fluoro-5-methyl-6-[(Z)-prop-1-enyl]-2-prop-1-en-2-ylnona-2,4,6,8-tetraen-1-imine |
| SMILES | C=C/N=C/C(=C/C=C(C)/C(/C=C\C)=C/C(=C)F)C(=C)C |
| InChI | InChI=1S/C18H22FN/c1-7-9-17(12-16(6)19)15(5)10-11-18(14(3)4)13-20-8-2/h7-13H,2-3,6H2,1,4-5H3/b9-7-,15-10+,17-12+,18-11-,20-13+ |
| InChIKey | FQOCIASARMFZFA-QUXJHBHZSA-N |
| XLogP | 5.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|