C21H29NO — CID 126516152
[2-ethyl-5-[(2E,4E)-5-ethyl-6-prop-1-en-2-yliminohepta-2,4-dien-2-yl]phenyl]methanol (PubChem CID 126516152) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is [2-ethyl-5-[(2E,4E)-5-ethyl-6-prop-1-en-2-yliminohepta-2,4-dien-2-yl]phenyl]methanol.
| Compound Name | [2-ethyl-5-[(2E,4E)-5-ethyl-6-prop-1-en-2-yliminohepta-2,4-dien-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126516152 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | [2-ethyl-5-[(2E,4E)-5-ethyl-6-prop-1-en-2-yliminohepta-2,4-dien-2-yl]phenyl]methanol |
| SMILES | C=C(C)/N=C(C)/C(=C/C=C(\C)c1ccc(CC)c(CO)c1)CC |
| InChI | InChI=1S/C21H29NO/c1-7-18(17(6)22-15(3)4)10-9-16(5)20-12-11-19(8-2)21(13-20)14-23/h9-13,23H,3,7-8,14H2,1-2,4-6H3/b16-9+,18-10+,22-17+ |
| InChIKey | PTBKJZUQTGETOQ-JVPAGSKHSA-N |
| XLogP | 5.48 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|