C25H29N5O3 — CID 126516245
5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methylbenzaldehyde (PubChem CID 126516245) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methylbenzaldehyde.
| Compound Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 126516245 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methylbenzaldehyde |
| SMILES | Cc1ccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)cc1C=O |
| InChI | InChI=1S/C25H29N5O3/c1-16-4-5-19(12-20(16)13-31)22-7-6-21-23(26-22)27-25(30-9-11-33-15-18(30)3)28-24(21)29-8-10-32-14-17(29)2/h4-7,12-13,17-18H,8-11,14-15H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | IDBWGKRLDFSMJR-ROUUACIJSA-N |
| XLogP | 3.26 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|