C20H26N2 — CID 126516283
(4Z,5E)-5-[(2E,5Z,7Z)-5-ethenyl-3,7-dimethylnona-2,5,7-trienylidene]-4-propylidenepyrimidine (PubChem CID 126516283) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (4Z,5E)-5-[(2E,5Z,7Z)-5-ethenyl-3,7-dimethylnona-2,5,7-trienylidene]-4-propylidenepyrimidine.
| Compound Name | (4Z,5E)-5-[(2E,5Z,7Z)-5-ethenyl-3,7-dimethylnona-2,5,7-trienylidene]-4-propylidenepyrimidine |
|---|---|
| PubChem CID | 126516283 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (4Z,5E)-5-[(2E,5Z,7Z)-5-ethenyl-3,7-dimethylnona-2,5,7-trienylidene]-4-propylidenepyrimidine |
| SMILES | C=C/C(=C\C(C)=C/C)C/C(C)=C/C=c1/cncn/c1=C\CC |
| InChI | InChI=1S/C20H26N2/c1-6-9-20-19(14-21-15-22-20)11-10-17(5)13-18(8-3)12-16(4)7-2/h7-12,14-15H,3,6,13H2,1-2,4-5H3/b16-7-,17-10+,18-12+,19-11-,20-9- |
| InChIKey | QJPGWSQCSLHGRT-NEVCEFISSA-N |
| XLogP | 3.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|