C25H28N2O2 — CID 126516284
[3-[(2E,4E)-5-[1-(2-methoxy-4H-azepin-6-yl)ethenyliminomethyl]-6-methylhepta-2,4,6-trien-2-yl]phenyl]methanol (PubChem CID 126516284) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [3-[(2E,4E)-5-[1-(2-methoxy-4H-azepin-6-yl)ethenyliminomethyl]-6-methylhepta-2,4,6-trien-2-yl]phenyl]methanol.
| Compound Name | [3-[(2E,4E)-5-[1-(2-methoxy-4H-azepin-6-yl)ethenyliminomethyl]-6-methylhepta-2,4,6-trien-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126516284 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [3-[(2E,4E)-5-[1-(2-methoxy-4H-azepin-6-yl)ethenyliminomethyl]-6-methylhepta-2,4,6-trien-2-yl]phenyl]methanol |
| SMILES | C=C(/N=C\C(=C\C=C(/C)c1cccc(CO)c1)C(=C)C)C1=CCC=C(OC)N=C1 |
| InChI | InChI=1S/C25H28N2O2/c1-18(2)23(13-12-19(3)22-9-6-8-21(14-22)17-28)15-26-20(4)24-10-7-11-25(29-5)27-16-24/h6,8-16,28H,1,4,7,17H2,2-3,5H3/b19-12+,23-13-,26-15+ |
| InChIKey | WYRZJVVMEAYOQN-ZVLLZFJOSA-N |
| XLogP | 5.56 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|