C25H35FN2 — CID 126516316
N-[[2-fluoro-6-[(2E,5E)-7-methyl-6-(C-methyl-N-propan-2-ylcarbonimidoyl)octa-2,5,7-trien-2-yl]cyclohepta-1,3,6-trien-1-yl]methyl]cyclopropanamine (PubChem CID 126516316) has the molecular formula C25H35FN2 and a molecular weight of 382.57 g/mol. Its IUPAC name is N-[[2-fluoro-6-[(2E,5E)-7-methyl-6-(C-methyl-N-propan-2-ylcarbonimidoyl)octa-2,5,7-trien-2-yl]cyclohepta-1,3,6-trien-1-yl]methyl]cyclopropanamine.
| Compound Name | N-[[2-fluoro-6-[(2E,5E)-7-methyl-6-(C-methyl-N-propan-2-ylcarbonimidoyl)octa-2,5,7-trien-2-yl]cyclohepta-1,3,6-trien-1-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 126516316 |
| Molecular Formula | C25H35FN2 |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | N-[[2-fluoro-6-[(2E,5E)-7-methyl-6-(C-methyl-N-propan-2-ylcarbonimidoyl)octa-2,5,7-trien-2-yl]cyclohepta-1,3,6-trien-1-yl]methyl]cyclopropanamine |
| SMILES | C=C(C)C(=C\C/C=C(\C)C1=CC(CNC2CC2)=C(F)C=CC1)/C(C)=N/C(C)C |
| InChI | InChI=1S/C25H35FN2/c1-17(2)24(20(6)28-18(3)4)11-7-9-19(5)21-10-8-12-25(26)22(15-21)16-27-23-13-14-23/h8-9,11-12,15,18,23,27H,1,7,10,13-14,16H2,2-6H3/b19-9+,24-11+,28-20+ |
| InChIKey | FNDBFHUOTKLHSW-IIYKXCRZSA-N |
| XLogP | 6.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|