C8H17IN2 — CID 126516325
1-(1-iodopiperidin-3-yl)-N,N-dimethylmethanamine (PubChem CID 126516325) has the molecular formula C8H17IN2 and a molecular weight of 268.14 g/mol. Its IUPAC name is 1-(1-iodopiperidin-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(1-iodopiperidin-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 126516325 |
| Molecular Formula | C8H17IN2 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1-(1-iodopiperidin-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCCN(I)C1 |
| InChI | InChI=1S/C8H17IN2/c1-10(2)6-8-4-3-5-11(9)7-8/h8H,3-7H2,1-2H3 |
| InChIKey | HPFAGEGYSZQOIH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|