C14H18N2 — CID 126516413
(5E)-5-[(2E,4E)-3,4-dimethylhexa-2,4-dienylidene]-2-methyl-4-methylidenepyrimidine (PubChem CID 126516413) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (5E)-5-[(2E,4E)-3,4-dimethylhexa-2,4-dienylidene]-2-methyl-4-methylidenepyrimidine.
| Compound Name | (5E)-5-[(2E,4E)-3,4-dimethylhexa-2,4-dienylidene]-2-methyl-4-methylidenepyrimidine |
|---|---|
| PubChem CID | 126516413 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (5E)-5-[(2E,4E)-3,4-dimethylhexa-2,4-dienylidene]-2-methyl-4-methylidenepyrimidine |
| SMILES | C=c1nc(C)nc/c1=C/C=C(C)/C(C)=C/C |
| InChI | InChI=1S/C14H18N2/c1-6-10(2)11(3)7-8-14-9-15-13(5)16-12(14)4/h6-9H,4H2,1-3,5H3/b10-6+,11-7+,14-8- |
| InChIKey | QYFHOOSJLXKHOR-SWQHIGECSA-N |
| XLogP | 1.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|