C13H16FN — CID 126516522
3-[(1Z)-buta-1,3-dienyl]-4-fluoro-N,2,6-trimethylaniline (PubChem CID 126516522) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-4-fluoro-N,2,6-trimethylaniline.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-4-fluoro-N,2,6-trimethylaniline |
|---|---|
| PubChem CID | 126516522 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-4-fluoro-N,2,6-trimethylaniline |
| SMILES | C=C/C=C\c1c(F)cc(C)c(NC)c1C |
| InChI | InChI=1S/C13H16FN/c1-5-6-7-11-10(3)13(15-4)9(2)8-12(11)14/h5-8,15H,1H2,2-4H3/b7-6- |
| InChIKey | IGKBTEBOLCKUDD-SREVYHEPSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|