About 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine
5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine (PubChem CID 126516559) has the molecular formula C23H23N3
and a molecular weight of 341.46 g/mol. Its IUPAC name is 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine.
Molecular Properties
| Compound Name | 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine |
| PubChem CID | 126516559 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine |
| SMILES | C=C(CN1CCCC1)c1cc2c(c3ncccc13)C(N)c1ccccc1-2 |
| InChI | InChI=1S/C23H23N3/c1-15(14-26-11-4-5-12-26)19-13-20-16-7-2-3-8-17(16)22(24)21(20)23-18(19)9-6-10-25-23/h2-3,6-10,13,22H,1,4-5,11-12,14,24H2 |
| InChIKey | ZPRFEGLQKWFWLF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine?
The IUPAC name of 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine (CID 126516559) is 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine.
What is the SMILES notation for 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine?
The canonical SMILES for 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine is C=C(CN1CCCC1)c1cc2c(c3ncccc13)C(N)c1ccccc1-2.
What is the InChIKey of 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine?
The InChIKey is ZPRFEGLQKWFWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3/c1-15(14-26-11-4-5-12-26)19-13-20-16-7-2-3-8-17(16)22(24)21(20)23-18(19)9-6-10-25-23/h2-3,6-10,13,22H,1,4-5,11-12,14,24H2.
What are the key properties of 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine?
5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine has a molecular weight of 341.46 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-pyrrolidin-1-ylprop-1-en-2-yl)-11H-indeno[1,2-h]quinolin-11-amine is sourced from PubChem (CID 126516559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).