About 8-nitro-1,8a-dihydroquinoline-7-carboxamide
8-nitro-1,8a-dihydroquinoline-7-carboxamide (PubChem CID 126516565) has the molecular formula C10H9N3O3
and a molecular weight of 219.20 g/mol. Its IUPAC name is 8-nitro-1,8a-dihydroquinoline-7-carboxamide.
Molecular Properties
| Compound Name | 8-nitro-1,8a-dihydroquinoline-7-carboxamide |
| PubChem CID | 126516565 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 8-nitro-1,8a-dihydroquinoline-7-carboxamide |
| SMILES | NC(=O)C1=C([N+](=O)[O-])C2NC=CC=C2C=C1 |
| InChI | InChI=1S/C10H9N3O3/c11-10(14)7-4-3-6-2-1-5-12-8(6)9(7)13(15)16/h1-5,8,12H,(H2,11,14) |
| InChIKey | FVICRNBZQYUWSY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-1,8a-dihydroquinoline-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-1,8a-dihydroquinoline-7-carboxamide?
The IUPAC name of 8-nitro-1,8a-dihydroquinoline-7-carboxamide (CID 126516565) is 8-nitro-1,8a-dihydroquinoline-7-carboxamide.
What is the SMILES notation for 8-nitro-1,8a-dihydroquinoline-7-carboxamide?
The canonical SMILES for 8-nitro-1,8a-dihydroquinoline-7-carboxamide is NC(=O)C1=C([N+](=O)[O-])C2NC=CC=C2C=C1.
What is the InChIKey of 8-nitro-1,8a-dihydroquinoline-7-carboxamide?
The InChIKey is FVICRNBZQYUWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c11-10(14)7-4-3-6-2-1-5-12-8(6)9(7)13(15)16/h1-5,8,12H,(H2,11,14).
What are the key properties of 8-nitro-1,8a-dihydroquinoline-7-carboxamide?
8-nitro-1,8a-dihydroquinoline-7-carboxamide has a molecular weight of 219.20 g/mol, XLogP of -0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-1,8a-dihydroquinoline-7-carboxamide is sourced from PubChem (CID 126516565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).