C20H20FN — CID 126516679
2-[(1Z)-buta-1,3-dienyl]-6-fluoro-1,3,7,9-tetramethylcarbazole (PubChem CID 126516679) has the molecular formula C20H20FN and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-6-fluoro-1,3,7,9-tetramethylcarbazole.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-6-fluoro-1,3,7,9-tetramethylcarbazole |
|---|---|
| PubChem CID | 126516679 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-6-fluoro-1,3,7,9-tetramethylcarbazole |
| SMILES | C=C/C=C\c1c(C)cc2c3cc(F)c(C)cc3n(C)c2c1C |
| InChI | InChI=1S/C20H20FN/c1-6-7-8-15-12(2)9-17-16-11-18(21)13(3)10-19(16)22(5)20(17)14(15)4/h6-11H,1H2,2-5H3/b8-7- |
| InChIKey | PJSOYJFLEAASNZ-FPLPWBNLSA-N |
| XLogP | 5.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|