C17H22O2 — CID 126516813
(8-methyl-6-propan-2-yl-1,7,8,8a-tetrahydronaphthalen-2-yl) prop-2-enoate (PubChem CID 126516813) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (8-methyl-6-propan-2-yl-1,7,8,8a-tetrahydronaphthalen-2-yl) prop-2-enoate.
| Compound Name | (8-methyl-6-propan-2-yl-1,7,8,8a-tetrahydronaphthalen-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 126516813 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (8-methyl-6-propan-2-yl-1,7,8,8a-tetrahydronaphthalen-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1=CC=C2C=C(C(C)C)CC(C)C2C1 |
| InChI | InChI=1S/C17H22O2/c1-5-17(18)19-15-7-6-13-9-14(11(2)3)8-12(4)16(13)10-15/h5-7,9,11-12,16H,1,8,10H2,2-4H3 |
| InChIKey | JANOTNQIZNWYSS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|