C10H13NO — CID 126516952
6,6-dimethyl-2,3-dihydrocyclohepta[d][1,3]oxazole (PubChem CID 126516952) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 6,6-dimethyl-2,3-dihydrocyclohepta[d][1,3]oxazole.
| Compound Name | 6,6-dimethyl-2,3-dihydrocyclohepta[d][1,3]oxazole |
|---|---|
| PubChem CID | 126516952 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6,6-dimethyl-2,3-dihydrocyclohepta[d][1,3]oxazole |
| SMILES | CC1(C)C=CC2=C(C=C1)OCN2 |
| InChI | InChI=1S/C10H13NO/c1-10(2)5-3-8-9(4-6-10)12-7-11-8/h3-6,11H,7H2,1-2H3 |
| InChIKey | XXQRKPKEVUDMDP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |