C14H23N — CID 126517133
4-[(2Z,4Z)-nona-2,4,7-trien-4-yl]piperidine (PubChem CID 126517133) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-[(2Z,4Z)-nona-2,4,7-trien-4-yl]piperidine.
| Compound Name | 4-[(2Z,4Z)-nona-2,4,7-trien-4-yl]piperidine |
|---|---|
| PubChem CID | 126517133 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4-[(2Z,4Z)-nona-2,4,7-trien-4-yl]piperidine |
| SMILES | CC=CC/C=C(\C=C/C)C1CCNCC1 |
| InChI | InChI=1S/C14H23N/c1-3-5-6-8-13(7-4-2)14-9-11-15-12-10-14/h3-5,7-8,14-15H,6,9-12H2,1-2H3/b5-3?,7-4-,13-8+ |
| InChIKey | MFGPJLLAVIBWNH-FCEIUNIBSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|