C18H32N2O — CID 126517203
(4Z,6Z)-4-ethenyl-1-piperidin-1-yl-2-(propan-2-ylamino)octa-4,6-dien-1-ol (PubChem CID 126517203) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is (4Z,6Z)-4-ethenyl-1-piperidin-1-yl-2-(propan-2-ylamino)octa-4,6-dien-1-ol.
| Compound Name | (4Z,6Z)-4-ethenyl-1-piperidin-1-yl-2-(propan-2-ylamino)octa-4,6-dien-1-ol |
|---|---|
| PubChem CID | 126517203 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | (4Z,6Z)-4-ethenyl-1-piperidin-1-yl-2-(propan-2-ylamino)octa-4,6-dien-1-ol |
| SMILES | C=C/C(=C\C=C/C)CC(NC(C)C)C(O)N1CCCCC1 |
| InChI | InChI=1S/C18H32N2O/c1-5-7-11-16(6-2)14-17(19-15(3)4)18(21)20-12-9-8-10-13-20/h5-7,11,15,17-19,21H,2,8-10,12-14H2,1,3-4H3/b7-5-,16-11+ |
| InChIKey | QXBZFXAWZYQLER-GDJQGNDCSA-N |
| XLogP | 3.24 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|