About 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine
1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine (PubChem CID 126517362) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine |
| PubChem CID | 126517362 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine |
| SMILES | CC(N)C1=C(F)C=CCC1 |
| InChI | InChI=1S/C8H12FN/c1-6(10)7-4-2-3-5-8(7)9/h3,5-6H,2,4,10H2,1H3 |
| InChIKey | XSHMJXAMRHGAEC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine?
The IUPAC name of 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine (CID 126517362) is 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine.
What is the SMILES notation for 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine?
The canonical SMILES for 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine is CC(N)C1=C(F)C=CCC1.
What is the InChIKey of 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine?
The InChIKey is XSHMJXAMRHGAEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN/c1-6(10)7-4-2-3-5-8(7)9/h3,5-6H,2,4,10H2,1H3.
What are the key properties of 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine?
1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine has a molecular weight of 141.19 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorocyclohexa-1,3-dien-1-yl)ethanamine is sourced from PubChem (CID 126517362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).