About 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol
3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol (PubChem CID 126517364) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol |
| PubChem CID | 126517364 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CC(C)NC(CO)CC1=CCCC=C1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)13-12(9-14)8-11-6-4-3-5-7-11/h4,6-7,10,12-14H,3,5,8-9H2,1-2H3 |
| InChIKey | VNSFOWQVIHYRLH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol (CID 126517364) is 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol is CC(C)NC(CO)CC1=CCCC=C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol?
The InChIKey is VNSFOWQVIHYRLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-10(2)13-12(9-14)8-11-6-4-3-5-7-11/h4,6-7,10,12-14H,3,5,8-9H2,1-2H3.
What are the key properties of 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol?
3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol has a molecular weight of 195.31 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yl-2-(propan-2-ylamino)propan-1-ol is sourced from PubChem (CID 126517364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).