C17H24Cl2N4 — CID 126517484
N-[(2E,4Z)-4-chloro-5-(4-chloro-1-methylpyrazol-5-yl)-2-methylhepta-2,4,6-trienyl]piperidin-3-amine (PubChem CID 126517484) has the molecular formula C17H24Cl2N4 and a molecular weight of 355.31 g/mol. Its IUPAC name is N-[(2E,4Z)-4-chloro-5-(4-chloro-1-methylpyrazol-5-yl)-2-methylhepta-2,4,6-trienyl]piperidin-3-amine.
| Compound Name | N-[(2E,4Z)-4-chloro-5-(4-chloro-1-methylpyrazol-5-yl)-2-methylhepta-2,4,6-trienyl]piperidin-3-amine |
|---|---|
| PubChem CID | 126517484 |
| Molecular Formula | C17H24Cl2N4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(2E,4Z)-4-chloro-5-(4-chloro-1-methylpyrazol-5-yl)-2-methylhepta-2,4,6-trienyl]piperidin-3-amine |
| SMILES | C=C/C(=C(Cl)\C=C(/C)CNC1CCCNC1)c1c(Cl)cnn1C |
| InChI | InChI=1S/C17H24Cl2N4/c1-4-14(17-16(19)11-22-23(17)3)15(18)8-12(2)9-21-13-6-5-7-20-10-13/h4,8,11,13,20-21H,1,5-7,9-10H2,2-3H3/b12-8+,15-14- |
| InChIKey | PTBJUJVGSSYQDN-PVESPXAVSA-N |
| XLogP | 3.50 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|