C19H26FN3S — CID 126517558
(1Z,3E)-5-(2-fluorocyclohexa-2,4-dien-1-yl)-1-(2-methylpyrazol-3-yl)-6-(propylamino)hexa-1,3-diene-1-thiol (PubChem CID 126517558) has the molecular formula C19H26FN3S and a molecular weight of 347.50 g/mol. Its IUPAC name is (1Z,3E)-5-(2-fluorocyclohexa-2,4-dien-1-yl)-1-(2-methylpyrazol-3-yl)-6-(propylamino)hexa-1,3-diene-1-thiol.
| Compound Name | (1Z,3E)-5-(2-fluorocyclohexa-2,4-dien-1-yl)-1-(2-methylpyrazol-3-yl)-6-(propylamino)hexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 126517558 |
| Molecular Formula | C19H26FN3S |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (1Z,3E)-5-(2-fluorocyclohexa-2,4-dien-1-yl)-1-(2-methylpyrazol-3-yl)-6-(propylamino)hexa-1,3-diene-1-thiol |
| SMILES | CCCNCC(/C=C/C=C(\S)c1ccnn1C)C1CC=CC=C1F |
| InChI | InChI=1S/C19H26FN3S/c1-3-12-21-14-15(16-8-4-5-9-17(16)20)7-6-10-19(24)18-11-13-22-23(18)2/h4-7,9-11,13,15-16,21,24H,3,8,12,14H2,1-2H3/b7-6+,19-10- |
| InChIKey | XUNZDRGDGCSQSY-XAUAACNYSA-N |
| XLogP | 4.29 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|