C24H38ClN5 — CID 126518376
N'-cyclohex-3-en-1-yl-N-[3-[4-(dimethylamino)cyclohexa-2,4-dien-1-yl]-1-(1,2,3,6-tetrahydropyridin-2-ylmethylamino)propyl]carbamimidoyl chloride (PubChem CID 126518376) has the molecular formula C24H38ClN5 and a molecular weight of 432.06 g/mol. Its IUPAC name is N'-cyclohex-3-en-1-yl-N-[3-[4-(dimethylamino)cyclohexa-2,4-dien-1-yl]-1-(1,2,3,6-tetrahydropyridin-2-ylmethylamino)propyl]carbamimidoyl chloride.
| Compound Name | N'-cyclohex-3-en-1-yl-N-[3-[4-(dimethylamino)cyclohexa-2,4-dien-1-yl]-1-(1,2,3,6-tetrahydropyridin-2-ylmethylamino)propyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 126518376 |
| Molecular Formula | C24H38ClN5 |
| Molecular Weight | 432.06 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | N'-cyclohex-3-en-1-yl-N-[3-[4-(dimethylamino)cyclohexa-2,4-dien-1-yl]-1-(1,2,3,6-tetrahydropyridin-2-ylmethylamino)propyl]carbamimidoyl chloride |
| SMILES | CN(C)C1=CCC(CCC(NCC2CC=CCN2)N/C(Cl)=N/C2CC=CCC2)C=C1 |
| InChI | InChI=1S/C24H38ClN5/c1-30(2)22-14-11-19(12-15-22)13-16-23(27-18-21-10-6-7-17-26-21)29-24(25)28-20-8-4-3-5-9-20/h3-4,6-7,11,14-15,19-21,23,26-27H,5,8-10,12-13,16-18H2,1-2H3,(H,28,29) |
| InChIKey | ICNSBJVRBJLWOW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.06 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|