C17H31NO — CID 126518656
(4Z,6Z)-4-amino-6-tert-butyl-8,9,9-trimethyldeca-1,4,6-trien-5-ol (PubChem CID 126518656) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (4Z,6Z)-4-amino-6-tert-butyl-8,9,9-trimethyldeca-1,4,6-trien-5-ol.
| Compound Name | (4Z,6Z)-4-amino-6-tert-butyl-8,9,9-trimethyldeca-1,4,6-trien-5-ol |
|---|---|
| PubChem CID | 126518656 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (4Z,6Z)-4-amino-6-tert-butyl-8,9,9-trimethyldeca-1,4,6-trien-5-ol |
| SMILES | C=CC/C(N)=C(O)\C(=C/C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H31NO/c1-9-10-14(18)15(19)13(17(6,7)8)11-12(2)16(3,4)5/h9,11-12,19H,1,10,18H2,2-8H3/b13-11+,15-14- |
| InChIKey | LGTLBCDPPMIQGG-RZVDUMMSSA-N |
| XLogP | 4.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|