About 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol
4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol (PubChem CID 126518661) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol |
| PubChem CID | 126518661 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol |
| SMILES | CNCCNC1=CC(O)NC=C1 |
| InChI | InChI=1S/C8H15N3O/c1-9-4-5-10-7-2-3-11-8(12)6-7/h2-3,6,8-12H,4-5H2,1H3 |
| InChIKey | PUVSMLRVJQNHMH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol?
The IUPAC name of 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol (CID 126518661) is 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol?
The canonical SMILES for 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol is CNCCNC1=CC(O)NC=C1.
What is the InChIKey of 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol?
The InChIKey is PUVSMLRVJQNHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-9-4-5-10-7-2-3-11-8(12)6-7/h2-3,6,8-12H,4-5H2,1H3.
What are the key properties of 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol?
4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol has a molecular weight of 169.23 g/mol, XLogP of -0.89, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(methylamino)ethylamino]-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 126518661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).