C31H34N2 — CID 126518692
(2E,4Z)-2-methyl-N'-[2-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]-3-phenylphenyl]hepta-2,4,6-trienimidamide (PubChem CID 126518692) has the molecular formula C31H34N2 and a molecular weight of 434.63 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-N'-[2-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]-3-phenylphenyl]hepta-2,4,6-trienimidamide.
| Compound Name | (2E,4Z)-2-methyl-N'-[2-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]-3-phenylphenyl]hepta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 126518692 |
| Molecular Formula | C31H34N2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (2E,4Z)-2-methyl-N'-[2-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]-3-phenylphenyl]hepta-2,4,6-trienimidamide |
| SMILES | C=C/C=C\C=C(C)\C(N)=N\c1cccc(-c2ccccc2)c1C(=C)CCC(=C)/C=C\C=C/C |
| InChI | InChI=1S/C31H34N2/c1-6-8-11-16-24(3)22-23-25(4)30-28(27-18-13-10-14-19-27)20-15-21-29(30)33-31(32)26(5)17-12-9-7-2/h6-21H,2-4,22-23H2,1,5H3,(H2,32,33)/b8-6-,12-9-,16-11-,26-17+ |
| InChIKey | JXMDKPMCKZKYAS-HDQNOJLQSA-N |
| XLogP | 8.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|