C33H35N5 — CID 126518777
N'-[N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-C-(2-methyl-6-phenylphenyl)carbonimidoyl]-5-[(Z)-1-methyliminobut-2-en-2-yl]pyridine-3-carboximidamide (PubChem CID 126518777) has the molecular formula C33H35N5 and a molecular weight of 501.68 g/mol. Its IUPAC name is N'-[N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-C-(2-methyl-6-phenylphenyl)carbonimidoyl]-5-[(Z)-1-methyliminobut-2-en-2-yl]pyridine-3-carboximidamide.
| Compound Name | N'-[N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-C-(2-methyl-6-phenylphenyl)carbonimidoyl]-5-[(Z)-1-methyliminobut-2-en-2-yl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 126518777 |
| Molecular Formula | C33H35N5 |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N'-[N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-C-(2-methyl-6-phenylphenyl)carbonimidoyl]-5-[(Z)-1-methyliminobut-2-en-2-yl]pyridine-3-carboximidamide |
| SMILES | C=C/C=C\C=C(/C)C/N=C(\N=C(/N)c1cncc(C(=C/C)/C=N/C)c1)c1c(C)cccc1-c1ccccc1 |
| InChI | InChI=1S/C33H35N5/c1-6-8-10-14-24(3)20-37-33(31-25(4)15-13-18-30(31)27-16-11-9-12-17-27)38-32(34)29-19-28(22-36-23-29)26(7-2)21-35-5/h6-19,21-23H,1,20H2,2-5H3,(H2,34,37,38)/b10-8-,24-14+,26-7+,35-21+ |
| InChIKey | HBYBAJIXBGKBON-GACWXEQCSA-N |
| XLogP | 7.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|