C22H24N4OS — CID 126520179
(1S,5R)-2-[(2-amino-4-pyridinyl)methylamino]-6,6-dimethyl-4-oxo-N-phenylbicyclo[3.1.1]hept-2-ene-3-carbothioamide (PubChem CID 126520179) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is (1S,5R)-2-[(2-amino-4-pyridinyl)methylamino]-6,6-dimethyl-4-oxo-N-phenylbicyclo[3.1.1]hept-2-ene-3-carbothioamide.
| Compound Name | (1S,5R)-2-[(2-amino-4-pyridinyl)methylamino]-6,6-dimethyl-4-oxo-N-phenylbicyclo[3.1.1]hept-2-ene-3-carbothioamide |
|---|---|
| PubChem CID | 126520179 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (1S,5R)-2-[(2-amino-4-pyridinyl)methylamino]-6,6-dimethyl-4-oxo-N-phenylbicyclo[3.1.1]hept-2-ene-3-carbothioamide |
| SMILES | CC1(C)[C@@H]2C[C@H]1C(=O)C(C(=S)Nc1ccccc1)=C2NCc1ccnc(N)c1 |
| InChI | InChI=1S/C22H24N4OS/c1-22(2)15-11-16(22)20(27)18(21(28)26-14-6-4-3-5-7-14)19(15)25-12-13-8-9-24-17(23)10-13/h3-10,15-16,25H,11-12H2,1-2H3,(H2,23,24)(H,26,28)/t15-,16+/m1/s1 |
| InChIKey | WYFIQKNVUVTICI-CVEARBPZSA-N |
| XLogP | 3.69 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|