C17H14N2 — CID 126521944
benzo[b]fluorene-11,11-diamine (PubChem CID 126521944) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is benzo[b]fluorene-11,11-diamine.
| Compound Name | benzo[b]fluorene-11,11-diamine |
|---|---|
| PubChem CID | 126521944 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | benzo[b]fluorene-11,11-diamine |
| SMILES | NC1(N)c2ccccc2-c2cc3ccccc3cc21 |
| InChI | InChI=1S/C17H14N2/c18-17(19)15-8-4-3-7-13(15)14-9-11-5-1-2-6-12(11)10-16(14)17/h1-10H,18-19H2 |
| InChIKey | IYLCXFNICDUGLB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|