About 2-(aminomethyl)-4,6-dichlorophenol
2-(aminomethyl)-4,6-dichlorophenol (PubChem CID 12652211) has the molecular formula C7H7Cl2NO
and a molecular weight of 192.04 g/mol. Its IUPAC name is 2-(aminomethyl)-4,6-dichlorophenol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-4,6-dichlorophenol |
| PubChem CID | 12652211 |
| Molecular Formula | C7H7Cl2NO |
| Molecular Weight | 192.04 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 2-(aminomethyl)-4,6-dichlorophenol |
| SMILES | NCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C7H7Cl2NO/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2,11H,3,10H2 |
| InChIKey | JTVDZUWMDWGQSB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.04 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-4,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-4,6-dichlorophenol?
The IUPAC name of 2-(aminomethyl)-4,6-dichlorophenol (CID 12652211) is 2-(aminomethyl)-4,6-dichlorophenol.
What is the SMILES notation for 2-(aminomethyl)-4,6-dichlorophenol?
The canonical SMILES for 2-(aminomethyl)-4,6-dichlorophenol is NCc1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 2-(aminomethyl)-4,6-dichlorophenol?
The InChIKey is JTVDZUWMDWGQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2NO/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2,11H,3,10H2.
What are the key properties of 2-(aminomethyl)-4,6-dichlorophenol?
2-(aminomethyl)-4,6-dichlorophenol has a molecular weight of 192.04 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-4,6-dichlorophenol is sourced from PubChem (CID 12652211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).