C14H14IN5 — CID 126523341
1-[5-(3-iodo-2H-pyrazolo[4,3-b]pyridin-5-yl)-3-pyridinyl]-N,N-dimethylmethanamine (PubChem CID 126523341) has the molecular formula C14H14IN5 and a molecular weight of 379.21 g/mol. Its IUPAC name is 1-[5-(3-iodo-2H-pyrazolo[4,3-b]pyridin-5-yl)-3-pyridinyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[5-(3-iodo-2H-pyrazolo[4,3-b]pyridin-5-yl)-3-pyridinyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 126523341 |
| Molecular Formula | C14H14IN5 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 1-[5-(3-iodo-2H-pyrazolo[4,3-b]pyridin-5-yl)-3-pyridinyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cncc(-c2ccc3n[nH]c(I)c3n2)c1 |
| InChI | InChI=1S/C14H14IN5/c1-20(2)8-9-5-10(7-16-6-9)11-3-4-12-13(17-11)14(15)19-18-12/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | YMHALQVKHQGDGH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|