C12H12Cl2N2O — CID 126524354
4,5-dichloro-2-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]pyridazin-3-one (PubChem CID 126524354) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 4,5-dichloro-2-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126524354 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4,5-dichloro-2-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]pyridazin-3-one |
| SMILES | C=C/C(C)=C\C=C/Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C12H12Cl2N2O/c1-3-9(2)6-4-5-7-16-12(17)11(14)10(13)8-15-16/h3-6,8H,1,7H2,2H3/b5-4-,9-6- |
| InChIKey | LJOCRCFUONRACQ-WXOLFVLTSA-N |
| XLogP | 3.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|