(2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid

C10H14O4 — CID 12652454

IUPAC(2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid
SMILESCC1(C)OC(=O)/C(=C\C(=O)O)C1(C)C
InChIInChI=1S/C10H14O4/c1-9(2)6(5-7(11)12)8(13)14-10(9,3)4/h5H,1-4H3,(H,11,12)/b6-5+
InChIKeyWQJURCLHELTNRB-AATRIKPKSA-N
MW198.22 g/mol
LogP1.36
Rot. Bonds1

About (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid

(2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid (PubChem CID 12652454) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid.

Molecular Properties

Compound Name(2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid
PubChem CID12652454
Molecular FormulaC10H14O4
Molecular Weight198.22 g/mol
Exact Mass198.09
IUPAC Name(2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid
SMILESCC1(C)OC(=O)/C(=C\C(=O)O)C1(C)C
InChIInChI=1S/C10H14O4/c1-9(2)6(5-7(11)12)8(13)14-10(9,3)4/h5H,1-4H3,(H,11,12)/b6-5+
InChIKeyWQJURCLHELTNRB-AATRIKPKSA-N
XLogP1.36
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid?
The IUPAC name of (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid (CID 12652454) is (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid.
What is the SMILES notation for (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid?
The canonical SMILES for (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid is CC1(C)OC(=O)/C(=C\C(=O)O)C1(C)C.
What is the InChIKey of (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid?
The InChIKey is WQJURCLHELTNRB-AATRIKPKSA-N. The full InChI is InChI=1S/C10H14O4/c1-9(2)6(5-7(11)12)8(13)14-10(9,3)4/h5H,1-4H3,(H,11,12)/b6-5+.
What are the key properties of (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid?
(2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid has a molecular weight of 198.22 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(4,4,5,5-tetramethyl-2-oxooxolan-3-ylidene)acetic acid is sourced from PubChem (CID 12652454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).