methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate

C11H18O4 — CID 12652455

IUPACmethyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate
SMILESCOC(=O)CC1C(=O)OC(C)(C)C1(C)C
InChIInChI=1S/C11H18O4/c1-10(2)7(6-8(12)14-5)9(13)15-11(10,3)4/h7H,6H2,1-5H3
InChIKeyWOLQSVPKMNHYKT-UHFFFAOYSA-N
MW214.26 g/mol
LogP1.53
Rot. Bonds2

About methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate

methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate (PubChem CID 12652455) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate
PubChem CID12652455
Molecular FormulaC11H18O4
Molecular Weight214.26 g/mol
Exact Mass214.12
IUPAC Namemethyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate
SMILESCOC(=O)CC1C(=O)OC(C)(C)C1(C)C
InChIInChI=1S/C11H18O4/c1-10(2)7(6-8(12)14-5)9(13)15-11(10,3)4/h7H,6H2,1-5H3
InChIKeyWOLQSVPKMNHYKT-UHFFFAOYSA-N
XLogP1.53
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.26
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate?
The IUPAC name of methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate (CID 12652455) is methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate.
What is the SMILES notation for methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate?
The canonical SMILES for methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate is COC(=O)CC1C(=O)OC(C)(C)C1(C)C.
What is the InChIKey of methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate?
The InChIKey is WOLQSVPKMNHYKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-10(2)7(6-8(12)14-5)9(13)15-11(10,3)4/h7H,6H2,1-5H3.
What are the key properties of methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate?
methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate has a molecular weight of 214.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,4,5,5-tetramethyl-2-oxooxolan-3-yl)acetate is sourced from PubChem (CID 12652455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).