C15H19F3N2O8S — CID 126525070
1-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyridin-1-ium-3-carboxamide;trifluoromethanesulfonate (PubChem CID 126525070) has the molecular formula C15H19F3N2O8S and a molecular weight of 444.38 g/mol. Its IUPAC name is 1-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyridin-1-ium-3-carboxamide;trifluoromethanesulfonate.
| Compound Name | 1-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyridin-1-ium-3-carboxamide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 126525070 |
| Molecular Formula | C15H19F3N2O8S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyridin-1-ium-3-carboxamide;trifluoromethanesulfonate |
| SMILES | CC1(C)OC2C(CO)OC([n+]3cccc(C(N)=O)c3)C2O1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H18N2O5.CHF3O3S/c1-14(2)20-10-9(7-17)19-13(11(10)21-14)16-5-3-4-8(6-16)12(15)18;2-1(3,4)8(5,6)7/h3-6,9-11,13,17H,7H2,1-2H3,(H-,15,18);(H,5,6,7) |
| InChIKey | XRAPPPLPPUXEJF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|