C22H22F5N2O9P — CID 126525333
[(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 126525333) has the molecular formula C22H22F5N2O9P and a molecular weight of 584.39 g/mol. Its IUPAC name is [(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 126525333 |
| Molecular Formula | C22H22F5N2O9P |
| Molecular Weight | 584.39 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | [(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | NC(=O)C1=CN([C@@H]2OC(COP3(=O)OCCC(c4cc(F)cc(F)c4)O3)[C@@H](OC(=O)C(F)(F)F)[C@H]2O)CC=C1 |
| InChI | InChI=1S/C22H22F5N2O9P/c23-13-6-12(7-14(24)8-13)15-3-5-34-39(33,38-15)35-10-16-18(37-21(32)22(25,26)27)17(30)20(36-16)29-4-1-2-11(9-29)19(28)31/h1-2,6-9,15-18,20,30H,3-5,10H2,(H2,28,31)/t15?,16?,17-,18-,20-,39?/m1/s1 |
| InChIKey | UDURNPRSBZMCPX-JOTZNTBVSA-N |
| XLogP | 2.37 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|