C12Cl2F8 — CID 12652582
1-chloro-4-(4-chloro-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene (PubChem CID 12652582) has the molecular formula C12Cl2F8 and a molecular weight of 367.02 g/mol. Its IUPAC name is 1-chloro-4-(4-chloro-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-chloro-4-(4-chloro-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 12652582 |
| Molecular Formula | C12Cl2F8 |
| Molecular Weight | 367.02 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | 1-chloro-4-(4-chloro-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(-c2c(F)c(F)c(Cl)c(F)c2F)c(F)c(F)c1Cl |
| InChI | InChI=1S/C12Cl2F8/c13-3-9(19)5(15)1(6(16)10(3)20)2-7(17)11(21)4(14)12(22)8(2)18 |
| InChIKey | OJGZFWYQULDFPL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.02 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|