C12H17BrFNOS — CID 126531678
N-[(1R)-1-(5-bromo-2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 126531678) has the molecular formula C12H17BrFNOS and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[(1R)-1-(5-bromo-2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-1-(5-bromo-2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 126531678 |
| Molecular Formula | C12H17BrFNOS |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-[(1R)-1-(5-bromo-2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@@H](NS(=O)C(C)(C)C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H17BrFNOS/c1-8(15-17(16)12(2,3)4)10-7-9(13)5-6-11(10)14/h5-8,15H,1-4H3/t8-,17?/m1/s1 |
| InChIKey | LPCOUCOIWQNOSF-OEWHWVHBSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |