About 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol
4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol (PubChem CID 12653262) has the molecular formula C13H26OSi
and a molecular weight of 226.44 g/mol. Its IUPAC name is 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol.
Molecular Properties
| Compound Name | 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol |
| PubChem CID | 12653262 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol |
| SMILES | C=C=C(C(O)(CCC)CCC)[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-7-10-13(14,11-8-2)12(9-3)15(4,5)6/h14H,3,7-8,10-11H2,1-2,4-6H3 |
| InChIKey | QAIIYJIHUJXOLM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol?
The IUPAC name of 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol (CID 12653262) is 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol.
What is the SMILES notation for 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol?
The canonical SMILES for 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol is C=C=C(C(O)(CCC)CCC)[Si](C)(C)C.
What is the InChIKey of 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol?
The InChIKey is QAIIYJIHUJXOLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OSi/c1-7-10-13(14,11-8-2)12(9-3)15(4,5)6/h14H,3,7-8,10-11H2,1-2,4-6H3.
What are the key properties of 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol?
4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol has a molecular weight of 226.44 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-3-trimethylsilylhepta-1,2-dien-4-ol is sourced from PubChem (CID 12653262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).