C23H26F2N6S — CID 126533643
1-(2,6-difluorophenyl)-5-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 126533643) has the molecular formula C23H26F2N6S and a molecular weight of 456.57 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-5-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 1-(2,6-difluorophenyl)-5-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 126533643 |
| Molecular Formula | C23H26F2N6S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-(2,6-difluorophenyl)-5-[3-[(4-methyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2CC3CCN(c4c(F)cccc4F)C3C2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C23H26F2N6S/c1-29-22(16-5-3-9-26-13-16)27-28-23(29)32-12-4-10-30-14-17-8-11-31(20(17)15-30)21-18(24)6-2-7-19(21)25/h2-3,5-7,9,13,17,20H,4,8,10-12,14-15H2,1H3 |
| InChIKey | RXHVJGSMDNGBHT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|