C24H27F3N6OS — CID 126533756
4-[5-[3-[(3aS,6aS)-6-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-3-methyl-1H-pyridin-2-one (PubChem CID 126533756) has the molecular formula C24H27F3N6OS and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-[5-[3-[(3aS,6aS)-6-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-3-methyl-1H-pyridin-2-one.
| Compound Name | 4-[5-[3-[(3aS,6aS)-6-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 126533756 |
| Molecular Formula | C24H27F3N6OS |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-[5-[3-[(3aS,6aS)-6-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1c(-c2nnc(SCCCN3C[C@@H]4CCN[C@@H]4C3c3c(F)cc(F)cc3F)n2C)cc[nH]c1=O |
| InChI | InChI=1S/C24H27F3N6OS/c1-13-16(5-7-29-23(13)34)22-30-31-24(32(22)2)35-9-3-8-33-12-14-4-6-28-20(14)21(33)19-17(26)10-15(25)11-18(19)27/h5,7,10-11,14,20-21,28H,3-4,6,8-9,12H2,1-2H3,(H,29,34)/t14-,20-,21?/m0/s1 |
| InChIKey | PQVFTZJLROEQSQ-DOXMUZONSA-N |
| XLogP | 3.41 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|