C23H31F3N6OS — CID 126533798
4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]morpholine (PubChem CID 126533798) has the molecular formula C23H31F3N6OS and a molecular weight of 496.60 g/mol. Its IUPAC name is 4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 126533798 |
| Molecular Formula | C23H31F3N6OS |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 4-[4-methyl-5-[3-[1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]morpholine |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(C(F)(F)F)cc4)C3C2)nnc1N1CCOCC1 |
| InChI | InChI=1S/C23H31F3N6OS/c1-29-21(31-10-12-33-13-11-31)27-28-22(29)34-14-2-8-30-15-17-7-9-32(20(17)16-30)19-5-3-18(4-6-19)23(24,25)26/h3-6,17,20H,2,7-16H2,1H3 |
| InChIKey | CLYZVNJXJPXTED-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|