C24H28FN7OS — CID 126534074
5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine-2-carboxamide (PubChem CID 126534074) has the molecular formula C24H28FN7OS and a molecular weight of 481.60 g/mol. Its IUPAC name is 5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine-2-carboxamide.
| Compound Name | 5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126534074 |
| Molecular Formula | C24H28FN7OS |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]pyridine-2-carboxamide |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(F)cc4)C3C2)nnc1-c1ccc(C(N)=O)nc1 |
| InChI | InChI=1S/C24H28FN7OS/c1-30-23(16-3-8-20(22(26)33)27-13-16)28-29-24(30)34-12-2-10-31-14-17-9-11-32(21(17)15-31)19-6-4-18(25)5-7-19/h3-8,13,17,21H,2,9-12,14-15H2,1H3,(H2,26,33) |
| InChIKey | BHNXJQYCDCKDKH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|