C23H26N8S — CID 126534462
2-[5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]benzonitrile (PubChem CID 126534462) has the molecular formula C23H26N8S and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-[5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]benzonitrile.
| Compound Name | 2-[5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 126534462 |
| Molecular Formula | C23H26N8S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[5-[3-[(4-methyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]benzonitrile |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccccc4C#N)C3C2)nnc1-c1cnccn1 |
| InChI | InChI=1S/C23H26N8S/c1-29-22(19-14-25-8-9-26-19)27-28-23(29)32-12-4-10-30-15-18-7-11-31(21(18)16-30)20-6-3-2-5-17(20)13-24/h2-3,5-6,8-9,14,18,21H,4,7,10-12,15-16H2,1H3 |
| InChIKey | QYAPJFAWWAJNJA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|